CAS 886762-24-9 is the registry number for 3,5-Dimethyl-2,4,6-trifluorobenzotrifluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,3,5-trifluoro-2,4-dimethyl-6-(trifluoromethyl)benzene (CAS 886762-24-9) is a chemical compound with the molecular formula C9H6F6 and a molecular weight of 228.13 g/mol. IUPAC name: 1,3,5-trifluoro-2,4-dimethyl-6-(trifluoromethyl)benzene. InChIKey: MSDUOIDZMMKMLT-UHFFFAOYSA-N.
| Molecular formula | C9H6F6 |
|---|---|
| Molecular weight | 228.13 g/mol |
| IUPAC name | 1,3,5-trifluoro-2,4-dimethyl-6-(trifluoromethyl)benzene |
| InChIKey | MSDUOIDZMMKMLT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)C(F)(F)F)F)C)F |
Computed by PubChem (NCBI)