Products 157928-43-3
CAS 157928-43-3 is the registry number for 1-(2,2,2-Trifluoroethyl)-4-trifluoromethylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene (CAS 157928-43-3) is a chemical compound with the molecular formula C9H6F6 and a molecular weight of 228.13 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene. InChIKey: ATCRSHAVNQIXGS-UHFFFAOYSA-N.
| Molecular formula | C9H6F6 |
|---|---|
| Molecular weight | 228.13 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene |
| InChIKey | ATCRSHAVNQIXGS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)