CAS 716-25-6 is the registry number for 4-Methyl-1,2-bis-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-methyl-1,2-bis(trifluoromethyl)benzene (CAS 716-25-6) is a chemical compound with the molecular formula C9H6F6 and a molecular weight of 228.13 g/mol. IUPAC name: 4-methyl-1,2-bis(trifluoromethyl)benzene. InChIKey: ZLZIWTFMKQRYNZ-UHFFFAOYSA-N.
| Molecular formula | C9H6F6 |
|---|---|
| Molecular weight | 228.13 g/mol |
| IUPAC name | 4-methyl-1,2-bis(trifluoromethyl)benzene |
| InChIKey | ZLZIWTFMKQRYNZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)