CAS 1138450-30-2 appears in our catalog under these names: 1-Methyl-3-trifluoromethylpyrazole-4-boronic acid, 98%, (1-Methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl)boronic acid 95%, (1-Methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl)boronic acid, 97%, 97%, (1-Methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]boronic acid (CAS 1138450-30-2) is a chemical compound with the molecular formula C5H6BF3N2O2 and a molecular weight of 193.92 g/mol. IUPAC name: [1-methyl-3-(trifluoromethyl)pyrazol-4-yl]boronic acid. InChIKey: CVTMJOHFLLGAIA-UHFFFAOYSA-N.
| Molecular formula | C5H6BF3N2O2 |
|---|---|
| Molecular weight | 193.92 g/mol |
| IUPAC name | [1-methyl-3-(trifluoromethyl)pyrazol-4-yl]boronic acid |
| InChIKey | CVTMJOHFLLGAIA-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)