Products 1338563-84-0
CAS 1338563-84-0 is the registry number for (3-methyl-5-(trifluoromethyl)-1H-pyrazol-4-yl)boronic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg.
[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]boronic acid (CAS 1338563-84-0) is a chemical compound with the molecular formula C5H6BF3N2O2 and a molecular weight of 193.92 g/mol. IUPAC name: [5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]boronic acid. InChIKey: CCUGYDZJPFZRDR-UHFFFAOYSA-N.
| Molecular formula | C5H6BF3N2O2 |
|---|---|
| Molecular weight | 193.92 g/mol |
| IUPAC name | [5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]boronic acid |
| InChIKey | CCUGYDZJPFZRDR-UHFFFAOYSA-N |
| SMILES | B(C1=C(NN=C1C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)