CAS 344591-91-9 appears in our catalog under these names: 1-Methyl-3-trifluoromethylpyrazole-5-boronic acid, 97% , (1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)boronic acid 97%, (1-Methyl-3-(Trifluoromethyl)-1H-Pyrazol-5-Yl)Boronic Acid, 98%, 98%, (1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)boronic acid, 95%. Offered by: Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 10g, 25g, 250mg, 100g.
[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]boronic acid (CAS 344591-91-9) is a chemical compound with the molecular formula C5H6BF3N2O2 and a molecular weight of 193.92 g/mol. IUPAC name: [1-methyl-3-(trifluoromethyl)pyrazol-5-yl]boronic acid. InChIKey: XPUNXPPXMANQGF-UHFFFAOYSA-N.
| Molecular formula | C5H6BF3N2O2 |
|---|---|
| Molecular weight | 193.92 g/mol |
| IUPAC name | [1-methyl-3-(trifluoromethyl)pyrazol-5-yl]boronic acid |
| InChIKey | XPUNXPPXMANQGF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NN1C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)