CAS 1138454-84-8 is the registry number for 6-Hydroxy-2-methyl Isoborneol. Offered by: TRC. Available pack sizes: 100mg.
1,2,7,7-tetramethylbicyclo[2.2.1]heptane-2,6-diol (CAS 1138454-84-8) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: 1,2,7,7-tetramethylbicyclo[2.2.1]heptane-2,6-diol. InChIKey: AGWPDIJKVDZOLV-UHFFFAOYSA-N.
| Molecular formula | C11H20O2 |
|---|---|
| Molecular weight | 184.27 g/mol |
| IUPAC name | 1,2,7,7-tetramethylbicyclo[2.2.1]heptane-2,6-diol |
| InChIKey | AGWPDIJKVDZOLV-UHFFFAOYSA-N |
| SMILES | CC1(C2CC(C1(C(C2)(C)O)C)O)C |
Computed by PubChem (NCBI)