Products 113869-04-8
CAS 113869-04-8 appears in our catalog under these names: Coumarin UV-389 Methyl Tetramethyl-, benzoquinolizine, 1 g, glass, Coumarin UV-389 Methyl Tetramethyl-, benzoquinolizine, 5 g, plastic, Coumarin UV-389 Methyl Tetramethyl-, benzoquinolizine, 10 g, plastic. Offered by: Roth. Available pack sizes: 1g, 5g, 10g.
6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (CAS 113869-04-8) is a chemical compound with the molecular formula C20H25NO2 and a molecular weight of 311.4 g/mol. IUPAC name: 6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one. InChIKey: UKPIALJRUISJAX-UHFFFAOYSA-N.
| Molecular formula | C20H25NO2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| InChIKey | UKPIALJRUISJAX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C3C4=C(C=C12)C(CCN4CCC3(C)C)(C)C |
Computed by PubChem (NCBI)