CAS 2173052-46-3 is the registry number for (2S,4R)-N-Ethyl-2-(4'-methoxybiphenyl-2-yl)tetrahydro-2h-pyran-4-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(2S,4R)-N-ethyl-2-[2-(4-methoxyphenyl)phenyl]oxan-4-amine (CAS 2173052-46-3) is a chemical compound with the molecular formula C20H25NO2 and a molecular weight of 311.4 g/mol. IUPAC name: (2S,4R)-N-ethyl-2-[2-(4-methoxyphenyl)phenyl]oxan-4-amine. InChIKey: ACEXRRNOQMCUOL-UZLBHIALSA-N.
| Molecular formula | C20H25NO2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | (2S,4R)-N-ethyl-2-[2-(4-methoxyphenyl)phenyl]oxan-4-amine |
| InChIKey | ACEXRRNOQMCUOL-UZLBHIALSA-N |
| SMILES | CCN[C@@H]1CCO[C@@H](C1)C2=CC=CC=C2C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)