Products 753421-85-1

CAS 753421-85-1 is the registry number for Sacubitril Impurity 40. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Ethyl (2S,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate (CAS 753421-85-1) is a chemical compound with the molecular formula C20H25NO2 and a molecular weight of 311.4 g/mol. IUPAC name: ethyl (2S,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate. InChIKey: OKDSPZRSANXDRL-KXBFYZLASA-N.

Identity
Molecular formulaC20H25NO2
Molecular weight311.4 g/mol
IUPAC nameethyl (2S,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate
InChIKeyOKDSPZRSANXDRL-KXBFYZLASA-N
SMILESCCOC(=O)[C@@H](C)C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)N

Computed by PubChem (NCBI)