CAS 752174-62-2 is the registry number for Sacubitril Impurity 26. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate (CAS 752174-62-2) is a chemical compound with the molecular formula C20H25NO2 and a molecular weight of 311.4 g/mol. IUPAC name: ethyl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate. InChIKey: OKDSPZRSANXDRL-BEFAXECRSA-N.
| Molecular formula | C20H25NO2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | ethyl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate |
| InChIKey | OKDSPZRSANXDRL-BEFAXECRSA-N |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)