CAS 113934-27-3 is the registry number for 1-(4-Chlorophenyl)-1h-1,2,3-triazole-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(4-chlorophenyl)triazole-4-carbaldehyde (CAS 113934-27-3) is a chemical compound with the molecular formula C9H6ClN3O and a molecular weight of 207.61 g/mol. IUPAC name: 1-(4-chlorophenyl)triazole-4-carbaldehyde. InChIKey: QMQRIACXYRMOBZ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 1-(4-chlorophenyl)triazole-4-carbaldehyde |
| InChIKey | QMQRIACXYRMOBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(N=N2)C=O)Cl |
Computed by PubChem (NCBI)