CAS 41886-28-6 is the registry number for 2-(3-Chlorophenyl)-2H-1,2,3-triazole-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3-chlorophenyl)triazole-4-carbaldehyde (CAS 41886-28-6) is a chemical compound with the molecular formula C9H6ClN3O and a molecular weight of 207.61 g/mol. IUPAC name: 2-(3-chlorophenyl)triazole-4-carbaldehyde. InChIKey: IWSSXGKTDMPCHE-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 2-(3-chlorophenyl)triazole-4-carbaldehyde |
| InChIKey | IWSSXGKTDMPCHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2N=CC(=N2)C=O |
Computed by PubChem (NCBI)