CAS 2288716-14-1 is the registry number for (2E)-3-(3-chloropyridin-4-yl)-2-cyanoprop-2-enamide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(E)-3-(3-chloro-4-pyridinyl)-2-cyanoprop-2-enamide (CAS 2288716-14-1) is a chemical compound with the molecular formula C9H6ClN3O and a molecular weight of 207.61 g/mol. IUPAC name: (E)-3-(3-chloro-4-pyridinyl)-2-cyanoprop-2-enamide. InChIKey: IKDUTZRJZDNIMG-XVNBXDOJSA-N.
| Molecular formula | C9H6ClN3O |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | (E)-3-(3-chloro-4-pyridinyl)-2-cyanoprop-2-enamide |
| InChIKey | IKDUTZRJZDNIMG-XVNBXDOJSA-N |
| SMILES | C1=CN=CC(=C1/C=C(\C#N)/C(=O)N)Cl |
Computed by PubChem (NCBI)