Products 113948-06-4

CAS 113948-06-4 is the registry number for N-Ethyl-3-iodobenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

N-ethyl-3-iodobenzamide (CAS 113948-06-4) is a chemical compound with the molecular formula C9H10INO and a molecular weight of 275.09 g/mol. IUPAC name: N-ethyl-3-iodobenzamide. InChIKey: DLJHACZHZRBDJF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10INO
Molecular weight275.09 g/mol
IUPAC nameN-ethyl-3-iodobenzamide
InChIKeyDLJHACZHZRBDJF-UHFFFAOYSA-N
SMILESCCNC(=O)C1=CC(=CC=C1)I

Computed by PubChem (NCBI)