Products 41882-26-2

CAS 41882-26-2 is the registry number for N-Ethyl-2-iodobenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

N-ethyl-2-iodobenzamide (CAS 41882-26-2) is a chemical compound with the molecular formula C9H10INO and a molecular weight of 275.09 g/mol. IUPAC name: N-ethyl-2-iodobenzamide. InChIKey: POTKZPJXRDJSEG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10INO
Molecular weight275.09 g/mol
IUPAC nameN-ethyl-2-iodobenzamide
InChIKeyPOTKZPJXRDJSEG-UHFFFAOYSA-N
SMILESCCNC(=O)C1=CC=CC=C1I

Computed by PubChem (NCBI)