Products 24167-53-1

CAS 24167-53-1 is the registry number for 4-Iodo-N,N-dimethylbenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

4-iodo-N,N-dimethylbenzamide (CAS 24167-53-1) is a chemical compound with the molecular formula C9H10INO and a molecular weight of 275.09 g/mol. IUPAC name: 4-iodo-N,N-dimethylbenzamide. InChIKey: ZPTKPSCMQWCYSN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10INO
Molecular weight275.09 g/mol
IUPAC name4-iodo-N,N-dimethylbenzamide
InChIKeyZPTKPSCMQWCYSN-UHFFFAOYSA-N
SMILESCN(C)C(=O)C1=CC=C(C=C1)I

Computed by PubChem (NCBI)