CAS 113975-32-9 appears in our catalog under these names: N–(4–Iodopyridin–3–yl)pivalamide, N-(4-Iodopyridin-3-yl)pivalamide, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
N-(4-iodo-3-pyridinyl)-2,2-dimethylpropanamide (CAS 113975-32-9) is a chemical compound with the molecular formula C10H13IN2O and a molecular weight of 304.13 g/mol. IUPAC name: N-(4-iodo-3-pyridinyl)-2,2-dimethylpropanamide. InChIKey: MWRKADKNFCJKNN-UHFFFAOYSA-N.
| Molecular formula | C10H13IN2O |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | N-(4-iodo-3-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | MWRKADKNFCJKNN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CN=C1)I |
Computed by PubChem (NCBI)