Products 114012-42-9
CAS 114012-42-9 appears in our catalog under these names: 3-Phenyloxetane-3-carboxylic acid, 95%, 3-Phenyloxetane-3-carboxylic acid 97%, 3-Phenyloxetane-3-carboxylic acid, 97%, 97%, 3-PHENYLOXETANE-3-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 500mg.
3-phenyloxetane-3-carboxylic acid (CAS 114012-42-9) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 3-phenyloxetane-3-carboxylic acid. InChIKey: WOMJGOIQQFWNKL-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 3-phenyloxetane-3-carboxylic acid |
| InChIKey | WOMJGOIQQFWNKL-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)