CAS 114012-82-7 is the registry number for 1-(3-Hydroxy-4,5-dimethoxyphenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3-hydroxy-4,5-dimethoxyphenyl)ethanone (CAS 114012-82-7) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 1-(3-hydroxy-4,5-dimethoxyphenyl)ethanone. InChIKey: HACSOPAIMQVSTM-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 1-(3-hydroxy-4,5-dimethoxyphenyl)ethanone |
| InChIKey | HACSOPAIMQVSTM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)OC)OC)O |
Computed by PubChem (NCBI)