Products 114021-62-4
CAS 114021-62-4 appears in our catalog under these names: 6'–Hydroxy–3，4，2'，3'，4'–pentamethoxychalcone, 6'-Hydroxy-3,4,2',3',4'-pentamethoxychalcone, 6'-Hydroxy-3,4,2',3',4'-pentamethoxychalcone, ≥98%, ≥98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 20mg, 1 mg, 5 mg, 10 mg.
(E)-3-(3,4-dimethoxyphenyl)-1-(6-hydroxy-2,3,4-trimethoxyphenyl)prop-2-en-1-one (CAS 114021-62-4) is a chemical compound with the molecular formula C20H22O7 and a molecular weight of 374.4 g/mol. IUPAC name: (E)-3-(3,4-dimethoxyphenyl)-1-(6-hydroxy-2,3,4-trimethoxyphenyl)prop-2-en-1-one. InChIKey: YYGVWBCOVUSNQT-SOFGYWHQSA-N.
| Molecular formula | C20H22O7 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (E)-3-(3,4-dimethoxyphenyl)-1-(6-hydroxy-2,3,4-trimethoxyphenyl)prop-2-en-1-one |
| InChIKey | YYGVWBCOVUSNQT-SOFGYWHQSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)C2=C(C(=C(C=C2O)OC)OC)OC)OC |
Computed by PubChem (NCBI)