CAS 61521-74-2 appears in our catalog under these names: (+)-Nortrachelogenin/ 99.64% (existing batch purity), (+)-Nortrachelogenin, (+)-Nortrachelogenin, 98.68%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
(3R,4R)-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one (CAS 61521-74-2) is a chemical compound with the molecular formula C20H22O7 and a molecular weight of 374.4 g/mol. IUPAC name: (3R,4R)-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one. InChIKey: ZITBJWXLODLDRH-JLTOFOAXSA-N.
| Molecular formula | C20H22O7 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (3R,4R)-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| InChIKey | ZITBJWXLODLDRH-JLTOFOAXSA-N |
| SMILES | COC1=C(C=CC(=C1)C[C@@H]2COC(=O)[C@]2(CC3=CC(=C(C=C3)O)OC)O)O |
Computed by PubChem (NCBI)