CAS 479672-30-5 appears in our catalog under these names: 3',4',5',5,7-Pentamethoxyflavanone, 3',4',5',5,7-Pentamethoxyflavanone, ≥98%, ≥98%. Offered by: TRC, TargetMol, MedChemExpress, Chemat. Available pack sizes: 100mg, 10mg, 1mg, 5mg, 25mg, 10 mg, 100 mg, 50mg.
5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-2,3-dihydrochromen-4-one (CAS 479672-30-5) is a chemical compound with the molecular formula C20H22O7 and a molecular weight of 374.4 g/mol. IUPAC name: 5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: VJQOZRFYJNWSFO-UHFFFAOYSA-N.
| Molecular formula | C20H22O7 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | VJQOZRFYJNWSFO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=O)CC(O2)C3=CC(=C(C(=C3)OC)OC)OC)C(=C1)OC |
Computed by PubChem (NCBI)