Products 1140242-88-1
CAS 1140242-88-1 is the registry number for 3-(2-Oxo-1,3-diazinan-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1000mg.
3-(2-oxo-1,3-diazinan-1-yl)benzoic acid (CAS 1140242-88-1) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 3-(2-oxo-1,3-diazinan-1-yl)benzoic acid. InChIKey: TWIMAQLGJSZRPW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 3-(2-oxo-1,3-diazinan-1-yl)benzoic acid |
| InChIKey | TWIMAQLGJSZRPW-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)N(C1)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)