CAS 1140528-29-5 appears in our catalog under these names: 3-(2-Methylphenyl)-1h-pyrazole-5-carboxylic acid, 98%, 3-(2-Methylphenyl)pyrazole-5-carboxylic acid, 98%, 3-(o-Tolyl)-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 1g, 5g.
3-(2-methylphenyl)-1H-pyrazole-5-carboxylic acid (CAS 1140528-29-5) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 3-(2-methylphenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: BHLFDODDOGJUGN-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-(2-methylphenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | BHLFDODDOGJUGN-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)