CAS 836619-82-0 appears in our catalog under these names: Ethyl 5,6,7-trifluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate, 95%, Ethyl 5,6,7-trifluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 0,5g, 50mg.
Ethyl 5,6,7-trifluoro-4-oxo-1H-quinoline-3-carboxylate (CAS 836619-82-0) is a chemical compound with the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. IUPAC name: ethyl 5,6,7-trifluoro-4-oxo-1H-quinoline-3-carboxylate. InChIKey: SREYUBSTHJZZGQ-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO3 |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | ethyl 5,6,7-trifluoro-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | SREYUBSTHJZZGQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=CC(=C(C(=C2C1=O)F)F)F |
Computed by PubChem (NCBI)