CAS 114087-45-5 appears in our catalog under these names: 6–Chloro–5–(trifluoromethyl)pyridine–2,3–diamine, 6-Chloro-5-(trifluoromethyl)pyridine-2,3-diamine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
6-chloro-5-(trifluoromethyl)pyridine-2,3-diamine (CAS 114087-45-5) is a chemical compound with the molecular formula C6H5ClF3N3 and a molecular weight of 211.57 g/mol. IUPAC name: 6-chloro-5-(trifluoromethyl)pyridine-2,3-diamine. InChIKey: JQYWJKAGWVLYTG-UHFFFAOYSA-N.
| Molecular formula | C6H5ClF3N3 |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | 6-chloro-5-(trifluoromethyl)pyridine-2,3-diamine |
| InChIKey | JQYWJKAGWVLYTG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1N)N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)