CAS 129015-69-6 is the registry number for 5-Chloro-2-hydrazinyl-3-(trifluoromethyl)pyridine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
[5-chloro-3-(trifluoromethyl)-2-pyridinyl]hydrazine (CAS 129015-69-6) is a chemical compound with the molecular formula C6H5ClF3N3 and a molecular weight of 211.57 g/mol. IUPAC name: [5-chloro-3-(trifluoromethyl)-2-pyridinyl]hydrazine. InChIKey: OYDFLZYOHRCSAV-UHFFFAOYSA-N.
| Molecular formula | C6H5ClF3N3 |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | [5-chloro-3-(trifluoromethyl)-2-pyridinyl]hydrazine |
| InChIKey | OYDFLZYOHRCSAV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)NN)Cl |
Computed by PubChem (NCBI)