CAS 1550419-78-7 appears in our catalog under these names: 2-Chloro-N-(2,2-difluoroethyl)-5-fluoropyrimidin-4-amine, 95%, 2-Chloro-N-(2,2-difluoroethyl)-5-fluoropyrimidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-chloro-N-(2,2-difluoroethyl)-5-fluoropyrimidin-4-amine (CAS 1550419-78-7) is a chemical compound with the molecular formula C6H5ClF3N3 and a molecular weight of 211.57 g/mol. IUPAC name: 2-chloro-N-(2,2-difluoroethyl)-5-fluoropyrimidin-4-amine. InChIKey: MRBYQKVHLLUQMD-UHFFFAOYSA-N.
| Molecular formula | C6H5ClF3N3 |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | 2-chloro-N-(2,2-difluoroethyl)-5-fluoropyrimidin-4-amine |
| InChIKey | MRBYQKVHLLUQMD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)Cl)NCC(F)F)F |
Computed by PubChem (NCBI)