CAS 1140898-87-8 appears in our catalog under these names: BMS 823778 Hydrochloride, BMS-823778 hydrochloride, BMS-823778 (hydrochloride). Offered by: TRC, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 250mg, 25mg, 50mg, 100mg, 10mg, Get quote.
2-[3-[1-(4-chlorophenyl)cyclopropyl]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]propan-2-ol;hydrochloride (CAS 1140898-87-8) is a chemical compound with the molecular formula C18H19Cl2N3O and a molecular weight of 364.3 g/mol. IUPAC name: 2-[3-[1-(4-chlorophenyl)cyclopropyl]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]propan-2-ol;hydrochloride. InChIKey: MQBBSMNIRWXALO-UHFFFAOYSA-N.
| Molecular formula | C18H19Cl2N3O |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | 2-[3-[1-(4-chlorophenyl)cyclopropyl]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]propan-2-ol;hydrochloride |
| InChIKey | MQBBSMNIRWXALO-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CN2C1=NN=C2C3(CC3)C4=CC=C(C=C4)Cl)O.Cl |
Computed by PubChem (NCBI)