Products 1246819-11-3
CAS 1246819-11-3 is the registry number for Amodiaquine impurity 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(7-chloroquinolin-4-yl)amino]-2-(ethylaminomethyl)phenol;hydrochloride (CAS 1246819-11-3) is a chemical compound with the molecular formula C18H19Cl2N3O and a molecular weight of 364.3 g/mol. IUPAC name: 4-[(7-chloroquinolin-4-yl)amino]-2-(ethylaminomethyl)phenol;hydrochloride. InChIKey: IWWFENVUWJIWLT-UHFFFAOYSA-N.
| Molecular formula | C18H19Cl2N3O |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | 4-[(7-chloroquinolin-4-yl)amino]-2-(ethylaminomethyl)phenol;hydrochloride |
| InChIKey | IWWFENVUWJIWLT-UHFFFAOYSA-N |
| SMILES | CCNCC1=C(C=CC(=C1)NC2=C3C=CC(=CC3=NC=C2)Cl)O.Cl |
Computed by PubChem (NCBI)