Products 892799-23-4
CAS 892799-23-4 is the registry number for (4-(3,4-dichlorophenyl)piperazinyl)-N-(2-methylphenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-(3,4-dichlorophenyl)-N-(2-methylphenyl)piperazine-1-carboxamide (CAS 892799-23-4) is a chemical compound with the molecular formula C18H19Cl2N3O and a molecular weight of 364.3 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-N-(2-methylphenyl)piperazine-1-carboxamide. InChIKey: KIXVLOFBKWTQKO-UHFFFAOYSA-N.
| Molecular formula | C18H19Cl2N3O |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-N-(2-methylphenyl)piperazine-1-carboxamide |
| InChIKey | KIXVLOFBKWTQKO-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)N2CCN(CC2)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)