CAS 114095-60-2 appears in our catalog under these names: trans–2–(3–methoxyphenyl)cyclopropylmethanol, trans-2-(3-methoxyphenyl)cyclopropylmethanol. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg.
[(1R,2R)-2-(3-methoxyphenyl)cyclopropyl]methanol (CAS 114095-60-2) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: [(1R,2R)-2-(3-methoxyphenyl)cyclopropyl]methanol. InChIKey: XVVIUIRIUFPGAG-ONGXEEELSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | [(1R,2R)-2-(3-methoxyphenyl)cyclopropyl]methanol |
| InChIKey | XVVIUIRIUFPGAG-ONGXEEELSA-N |
| SMILES | COC1=CC=CC(=C1)[C@@H]2C[C@H]2CO |
Computed by PubChem (NCBI)