CAS 1141-54-4 is the registry number for (R)-ar-Turmerone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6R)-2-methyl-6-(4-methylphenyl)hept-2-en-4-one (CAS 1141-54-4) is a chemical compound with the molecular formula C15H20O and a molecular weight of 216.32 g/mol. IUPAC name: (6R)-2-methyl-6-(4-methylphenyl)hept-2-en-4-one. InChIKey: NAAJVHHFAXWBOK-CYBMUJFWSA-N.
| Molecular formula | C15H20O |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | (6R)-2-methyl-6-(4-methylphenyl)hept-2-en-4-one |
| InChIKey | NAAJVHHFAXWBOK-CYBMUJFWSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H](C)CC(=O)C=C(C)C |
Computed by PubChem (NCBI)