CAS 60263-12-9 appears in our catalog under these names: 7-Hydroxy-3,4-Dihydro Cadalin, (±)-7-Hydroxy-3,4-dihydrocadalin. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
3,8-dimethyl-5-propan-2-yl-5,6-dihydronaphthalen-2-ol (CAS 60263-12-9) is a chemical compound with the molecular formula C15H20O and a molecular weight of 216.32 g/mol. IUPAC name: 3,8-dimethyl-5-propan-2-yl-5,6-dihydronaphthalen-2-ol. InChIKey: YZHICMXANUYYLB-UHFFFAOYSA-N.
| Molecular formula | C15H20O |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | 3,8-dimethyl-5-propan-2-yl-5,6-dihydronaphthalen-2-ol |
| InChIKey | YZHICMXANUYYLB-UHFFFAOYSA-N |
| SMILES | CC1=CCC(C2=C1C=C(C(=C2)C)O)C(C)C |
Computed by PubChem (NCBI)