CAS 72943-94-3 is the registry number for 3-Hydroxy-alfa-Calacorene. Offered by: Chemat Brand. Available pack sizes: on request.
(5S)-3,8-dimethyl-5-propan-2-yl-5,6-dihydronaphthalen-2-ol (CAS 72943-94-3) is a chemical compound with the molecular formula C15H20O and a molecular weight of 216.32 g/mol. IUPAC name: (5S)-3,8-dimethyl-5-propan-2-yl-5,6-dihydronaphthalen-2-ol. InChIKey: YZHICMXANUYYLB-LBPRGKRZSA-N.
| Molecular formula | C15H20O |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | (5S)-3,8-dimethyl-5-propan-2-yl-5,6-dihydronaphthalen-2-ol |
| InChIKey | YZHICMXANUYYLB-LBPRGKRZSA-N |
| SMILES | CC1=CC[C@H](C2=C1C=C(C(=C2)C)O)C(C)C |
Computed by PubChem (NCBI)