CAS 255836-59-0 is the registry number for 2,2-Dimethyl-5-(2,6-dimethylphenyl)cyclopentanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
5-(2,6-dimethylphenyl)-2,2-dimethylcyclopentan-1-one (CAS 255836-59-0) is a chemical compound with the molecular formula C15H20O and a molecular weight of 216.32 g/mol. IUPAC name: 5-(2,6-dimethylphenyl)-2,2-dimethylcyclopentan-1-one. InChIKey: PAOJFJSDCWZQHZ-UHFFFAOYSA-N.
| Molecular formula | C15H20O |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | 5-(2,6-dimethylphenyl)-2,2-dimethylcyclopentan-1-one |
| InChIKey | PAOJFJSDCWZQHZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C2CCC(C2=O)(C)C |
Computed by PubChem (NCBI)