Products 114177-03-6
CAS 114177-03-6 is the registry number for methyl 7-(tert-butyl)-3-hydroxy-2-naphthoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 7-tert-butyl-3-hydroxynaphthalene-2-carboxylate (CAS 114177-03-6) is a chemical compound with the molecular formula C16H18O3 and a molecular weight of 258.31 g/mol. IUPAC name: methyl 7-tert-butyl-3-hydroxynaphthalene-2-carboxylate. InChIKey: RNGXORAMUFUQMD-UHFFFAOYSA-N.
| Molecular formula | C16H18O3 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | methyl 7-tert-butyl-3-hydroxynaphthalene-2-carboxylate |
| InChIKey | RNGXORAMUFUQMD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=CC(=C(C=C2C=C1)O)C(=O)OC |
Computed by PubChem (NCBI)