Products 1141886-66-9
CAS 1141886-66-9 appears in our catalog under these names: exo–Tropine–3–thiol Hydrochloride, Exo-tropine-3-thiol hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 25g, 5g, 5mg, 10mg, 25mg, 50mg.
(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octane-3-thiol;hydrochloride (CAS 1141886-66-9) is a chemical compound with the molecular formula C8H16ClNS and a molecular weight of 193.74 g/mol. IUPAC name: (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octane-3-thiol;hydrochloride. InChIKey: IOTZTIZFEAOBRO-PAFGHYSMSA-N.
| Molecular formula | C8H16ClNS |
|---|---|
| Molecular weight | 193.74 g/mol |
| IUPAC name | (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octane-3-thiol;hydrochloride |
| InChIKey | IOTZTIZFEAOBRO-PAFGHYSMSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)S.Cl |
Computed by PubChem (NCBI)