CAS 908266-48-8 appears in our catalog under these names: Tropine-3-thiol Hydrochloride, 95+%, Tropine-3-thiol Hydrochloride, >95% (HPLC), Retapamulin Impurity 8. Offered by: AmBeed, TRC, Chemat Brand. Available pack sizes: 5g, 1g, 25g, on request.
(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octane-3-thiol;hydrochloride (CAS 908266-48-8) is a chemical compound with the molecular formula C8H16ClNS and a molecular weight of 193.74 g/mol. IUPAC name: (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octane-3-thiol;hydrochloride. InChIKey: IOTZTIZFEAOBRO-PAFGHYSMSA-N.
| Molecular formula | C8H16ClNS |
|---|---|
| Molecular weight | 193.74 g/mol |
| IUPAC name | (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octane-3-thiol;hydrochloride |
| InChIKey | IOTZTIZFEAOBRO-PAFGHYSMSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)S.Cl |
Computed by PubChem (NCBI)