Products 2248199-11-1
CAS 2248199-11-1 is the registry number for (3aR,6aS)-3a,6a-Dimethyl-hexahydro-1H-thieno(3,4-c)pyrrole hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3aR,6aS)-3a,6a-dimethyl-3,4,5,6-tetrahydro-1H-thieno[3,4-c]pyrrole;hydrochloride (CAS 2248199-11-1) is a chemical compound with the molecular formula C8H16ClNS and a molecular weight of 193.74 g/mol. IUPAC name: (3aR,6aS)-3a,6a-dimethyl-3,4,5,6-tetrahydro-1H-thieno[3,4-c]pyrrole;hydrochloride. InChIKey: QLHHYMJTTWOBFO-KVZVIFLMSA-N.
| Molecular formula | C8H16ClNS |
|---|---|
| Molecular weight | 193.74 g/mol |
| IUPAC name | (3aR,6aS)-3a,6a-dimethyl-3,4,5,6-tetrahydro-1H-thieno[3,4-c]pyrrole;hydrochloride |
| InChIKey | QLHHYMJTTWOBFO-KVZVIFLMSA-N |
| SMILES | C[C@]12CNC[C@]1(CSC2)C.Cl |
Computed by PubChem (NCBI)