CAS 114204-62-5 is the registry number for 4-(5-Amino-1,3,4-thiadiazol-2-yl)-2-methoxyphenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(5-amino-1,3,4-thiadiazol-2-yl)-2-methoxyphenol (CAS 114204-62-5) is a chemical compound with the molecular formula C9H9N3O2S and a molecular weight of 223.25 g/mol. IUPAC name: 4-(5-amino-1,3,4-thiadiazol-2-yl)-2-methoxyphenol. InChIKey: BSPCBZUBIMXXLE-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 4-(5-amino-1,3,4-thiadiazol-2-yl)-2-methoxyphenol |
| InChIKey | BSPCBZUBIMXXLE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=NN=C(S2)N)O |
Computed by PubChem (NCBI)