CAS 13578-51-3 appears in our catalog under these names: 1–(p–Toluenesulfonyl)–1,2,4–triazole, 1-(p-Toluenesulfonyl)-1,2,4-triazole, >98.0%(HPLC), 1-[(4-Methylphenyl)sulfonyl]-1H-1,2,4-triazole, ≥98%, ≥98%, 1-Tosyl-1H-1,2,4-triazole, ≥98%(HPLC). Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 500g.
1-(4-methylphenyl)sulfonyl-1,2,4-triazole (CAS 13578-51-3) is a chemical compound with the molecular formula C9H9N3O2S and a molecular weight of 223.25 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-1,2,4-triazole. InChIKey: GFWABQNSSIQCLB-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-1,2,4-triazole |
| InChIKey | GFWABQNSSIQCLB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=NC=N2 |
Computed by PubChem (NCBI)