CAS 1523205-22-2 is the registry number for 2-(1,5-Dimethyl-1H-pyrazol-3-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,5-dimethylpyrazol-3-yl)-1,3-thiazole-4-carboxylic acid (CAS 1523205-22-2) is a chemical compound with the molecular formula C9H9N3O2S and a molecular weight of 223.25 g/mol. IUPAC name: 2-(1,5-dimethylpyrazol-3-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: VCLTZCGQVFBGQB-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 2-(1,5-dimethylpyrazol-3-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | VCLTZCGQVFBGQB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)