Products 1523205-22-2

CAS 1523205-22-2 is the registry number for 2-(1,5-Dimethyl-1H-pyrazol-3-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(1,5-dimethylpyrazol-3-yl)-1,3-thiazole-4-carboxylic acid (CAS 1523205-22-2) is a chemical compound with the molecular formula C9H9N3O2S and a molecular weight of 223.25 g/mol. IUPAC name: 2-(1,5-dimethylpyrazol-3-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: VCLTZCGQVFBGQB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9N3O2S
Molecular weight223.25 g/mol
IUPAC name2-(1,5-dimethylpyrazol-3-yl)-1,3-thiazole-4-carboxylic acid
InChIKeyVCLTZCGQVFBGQB-UHFFFAOYSA-N
SMILESCC1=CC(=NN1C)C2=NC(=CS2)C(=O)O

Computed by PubChem (NCBI)