CAS 1142191-95-4 is the registry number for Methyl 6-chloro-5-pivalamidopicolinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 6-chloro-5-(2,2-dimethylpropanoylamino)pyridine-2-carboxylate (CAS 1142191-95-4) is a chemical compound with the molecular formula C12H15ClN2O3 and a molecular weight of 270.71 g/mol. IUPAC name: methyl 6-chloro-5-(2,2-dimethylpropanoylamino)pyridine-2-carboxylate. InChIKey: MRLNFXVKFSJUHZ-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O3 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | methyl 6-chloro-5-(2,2-dimethylpropanoylamino)pyridine-2-carboxylate |
| InChIKey | MRLNFXVKFSJUHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(N=C(C=C1)C(=O)OC)Cl |
Computed by PubChem (NCBI)