CAS 1185302-47-9 appears in our catalog under these names: ([5-(3,4-Dimethoxyphenyl)isoxazol-3-yl]methyl)amine hydrochloride, 95%, (5-(3,4-Dimethoxyphenyl)isoxazol-3-yl)methanamine hydrochloride, 97%, (5-(3,4-Dimethoxyphenyl)-1,2-oxazol-3-yl)methanamine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
[5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride (CAS 1185302-47-9) is a chemical compound with the molecular formula C12H15ClN2O3 and a molecular weight of 270.71 g/mol. IUPAC name: [5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride. InChIKey: LFXYNBWPFOMINX-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O3 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | [5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride |
| InChIKey | LFXYNBWPFOMINX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=NO2)CN)OC.Cl |
Computed by PubChem (NCBI)