CAS 1332530-01-4 appears in our catalog under these names: 1-(1,3-Benzodioxol-5-ylmethyl)-2-piperazinone hydrochloride, 95%, 1-(Benzo(d)(1,3)dioxol-5-ylmethyl)piperazin-2-one hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(1,3-benzodioxol-5-ylmethyl)piperazin-2-one;hydrochloride (CAS 1332530-01-4) is a chemical compound with the molecular formula C12H15ClN2O3 and a molecular weight of 270.71 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-ylmethyl)piperazin-2-one;hydrochloride. InChIKey: QEZAJGNSIPURSX-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O3 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-ylmethyl)piperazin-2-one;hydrochloride |
| InChIKey | QEZAJGNSIPURSX-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)CC2=CC3=C(C=C2)OCO3.Cl |
Computed by PubChem (NCBI)