CAS 1142192-34-4 is the registry number for N-(2-Bromo-5-formylpyridin-3-yl)pivalamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2-bromo-5-formyl-3-pyridinyl)-2,2-dimethylpropanamide (CAS 1142192-34-4) is a chemical compound with the molecular formula C11H13BrN2O2 and a molecular weight of 285.14 g/mol. IUPAC name: N-(2-bromo-5-formyl-3-pyridinyl)-2,2-dimethylpropanamide. InChIKey: GNGDIUMPJFTUSP-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O2 |
|---|---|
| Molecular weight | 285.14 g/mol |
| IUPAC name | N-(2-bromo-5-formyl-3-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | GNGDIUMPJFTUSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(N=CC(=C1)C=O)Br |
Computed by PubChem (NCBI)