Products 954267-45-9
CAS 954267-45-9 appears in our catalog under these names: 1-(5-Bromopyridin-2-yl)piperidine-3-carboxylic acid, 97%, 1-(5-Bromopyridin-2-yl)piperidine-3-carboxylic acid, 98+%, 1-(5-Bromopyridin-2-yl)piperidine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 2,5g.
1-(5-bromo-2-pyridinyl)piperidine-3-carboxylic acid (CAS 954267-45-9) is a chemical compound with the molecular formula C11H13BrN2O2 and a molecular weight of 285.14 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)piperidine-3-carboxylic acid. InChIKey: SNUOLUXXDCFITF-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O2 |
|---|---|
| Molecular weight | 285.14 g/mol |
| IUPAC name | 1-(5-bromo-2-pyridinyl)piperidine-3-carboxylic acid |
| InChIKey | SNUOLUXXDCFITF-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=NC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)