Products 954570-88-8
CAS 954570-88-8 is the registry number for 1-(5-Bromopyridin-2-yl)piperidine-4-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 5g, 25g, 1g.
1-(5-bromo-2-pyridinyl)piperidine-4-carboxylic acid (CAS 954570-88-8) is a chemical compound with the molecular formula C11H13BrN2O2 and a molecular weight of 285.14 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)piperidine-4-carboxylic acid. InChIKey: UZHCKHPUYLVRFG-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O2 |
|---|---|
| Molecular weight | 285.14 g/mol |
| IUPAC name | 1-(5-bromo-2-pyridinyl)piperidine-4-carboxylic acid |
| InChIKey | UZHCKHPUYLVRFG-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)